CSUMB
ESSP 311 Organic Chemistry I
Ronald W. Rinehart, Ph.D.
Chapter 5
Alkenes: Structure and Preparation
Elimination Reactions
| My table of alkenes |
| A far more extensive library of stick
and Chime structures of alkenes by Dave Woodcock at OUC http://www.molecularmodels.ca/molecule/Alkenes.htm |
| Carey PowerPoint slides
for chapter 5 from Columbia University [5.1 to 5.4, nomenclature, structure & bonding, isomerism, (E)/(Z) notation] http://www.columbia.edu/itc/chemistry/c3045/client_edit/ppt/05_01_04.html |
| Carey PowerPoint slides
for chapter 5 from Columbia University [5.5 to 5.7, physical properties, stability, cycloalkenes] http://www.columbia.edu/itc/chemistry/c3045/client_edit/ppt/05_05_07.html |
| Carey PowerPoint slides
for chapter 5 from Columbia University [5.8 to 5.13, preparation via elimination rxns: dehydration of alcohols, regio- and stereoselectivity, Zaitsev's rule, E1 mechanism, rearrangements] http://www.columbia.edu/itc/chemistry/c3045/client_edit/ppt/05_08_13.html |
| Carey PowerPoint slides
for chapter 5 from Columbia University [5.14 to 5.17, preparation via elimination rxns: dehydrohalogenation of alkyl halides, E2 mechanism, anti elimination & stereoelectronic effects, E1 in RX] http://www.columbia.edu/itc/chemistry/c3045/client_edit/ppt/05_14_17.html |
| Lots of organic tutorials are
available at Molecules in 4 Dimensions from The Center for Molecular and Biomolecular Informatics, CMBI at U Nijmegen http://www.cmbi.kun.nl/wetche/organic/subjmenu.html Requires Chime™ -- use Netscape |
| PowerPoint slides on substitution
and elimination reactions of alkyl halides by Paul R. Young of the University of Illinois at Chicago are viewable [with Adobe Acrobat Reader™] at http://www.chem.uic.edu/web1/PDF/CH6.PDF |
| Alkyl halides by Gary Trammell and
Srinivas Vuppuluri at the University of Illinois at Springfield has info on structure, preparation, and elimination and nucleophilic substitution http://people.uis.edu/gtram1/organic/alkylHalidesmenu.htm |
|
Elimination reactions of alkyl halides from the Virtual Textbook of Organic Chemistry by William Reusch at Michigan State U http://www.cem.msu.edu/~reusch/VirtualText/alhalrx3.htm#hal6 other reactions of RX at http://www.cem.msu.edu/~reusch/VirtualText/alhalrx1.htm#hal1 |
|
Elimination reactions of alcohols from the Virtual Textbook of Organic Chemistry by William Reusch at Michigan State U http://www.cem.msu.edu/~reusch/VirtualText/alcohol1.htm#alcrx3 |
| Animations of E1 and E2 mechanisms
by Daniel A. Berger of Bluffton College are at http://www.bluffton.edu/~bergerd/classes/CEM221/sn-e/E1-1.html http://www.bluffton.edu/~bergerd/classes/CEM221/sn-e/E2-1.html |
| Animations of E1 and E2 mechanisms
by Jennifer L. Muzyka at Centre College http://web.centre.edu/muzyka/organic/organic.htm > Substitution and Elimination http://web.centre.edu/~muzyka/organic/e1/main.htm http://web.centre.edu/~muzyka/organic/e2/main.htm |
Chapter 5. Structure and Preparation of Alkenes. Elimination Reactions.
I.
Structure and Bonding.
A. Double Bond: C=C
B. Planar, 120o Bond Angles.
C. Bonding
1. sp2 hybrid orbitals.
2. One p orbital is perpendicular to the plane
of sp2 hybrids.
3. Sigma (s) bonds: end-to-end overlap
utilizing sp2 hybrids.
4. Pi (p) bonds: sideways overlap of
parallel, in-phase p orbitals.
5. C-C vs C=C bond lengths/strengths:
|
bond |
length, |
length, |
strength, kcal/mol |
strength, |
|
C-C |
1.53 Å |
153 pm |
83 | 347 |
|
C=C |
1.34 Å |
134 pm |
146 | 611 |
6. In propene the C2-C3 bond length is shorter (1.50
Å) than the C2-C3 bond length in propane (1.53 Å).
Why?
C=C−C vs C−C−C
sp2- sp3 sp3-sp3
Answer:
The greater s character
sp2 hybrid orbital bonds electrons more strongly than
the sp3 hybrid,
contracting the sigma bond and shortening the internuclear distance.
7. The pi bond:
|
bonding orbital p |
antibonding orbital p* |
|
|
|
8. The pi bond leads to stereoisomerism: cis/trans (Z/E).
|
|
|
|
cis isomer |
trans isomer |
II. Nomenclature of Alkenes.
|
Alkene Nomenclature by Dave Woodcock at Okanagan
University College |
|
Alkene Nomenclature by Paul R. Young of the
University of Illinois at Chicago |
|
Alkene Nomenclature by Susan Barrows at Penn
State University, Schuylkill |
A. IUPAC System. The nomenclature of alkenes is very
similar to the nomenclature of alkanes.
A few important differences are listed:
1. Replace -ane ending of corresponding alkane
with -ene.
2. The parent chain must be the longest continuous
carbon chain containing the C=C group.
a) The parent chain is therefore not
always the longest carbon chain in the compound.
|
|
3. Always number the parent such that the C=C carbons
are given the lowest possible numbers,
and only one number is given in the name.
CH3CH2CH=CH2
1-butene, not 1,2-butene or 3-butene
a) Name this alkene: [highlight area below structure to check]
|
|
|
5-methyl-2-hexene |
4. In cycloalkenes the C=C linkage is automatically
given the numbers 1 and 2, so this is not
mentioned in the name (cyclohexene).
5. If two or more C=C groups are in a compound, the
name of the compound ends with
-adiene, -atriene,
etc.
a) Name the following:
|
|
|
|
3-methyl-2,4-hexadiene |
7-ethyl-4,4,8-trimethyl-1,5-nonadiene |
B. Common Names
1. Some alkenes are known by common names:
|
Alkene |
IUPAC |
Common |
|
|
ethene |
ethylene |
|
|
propene |
propylene |
|
|
2-methylpropene |
isobutylene |
|
|
2-methyl-1,3-butadiene |
isoprene |
2. Just as there are alkyl groups, alkenyl groups are based upon the corresponding alkene:
|
Alkenyl Group |
IUPAC |
Common |
|
|
ethenyl |
vinyl |
|
|
propenyl |
allyl |
|
|
methylene |
methylene |
|
|
ethylidene |
ethylidene |
|
|
1-methylethenyl |
isopropenyl |
C. Geometric Isomerism: cis/trans Isomers and the E-Z System
1. Since rotation about the double bond cannot occur,
geometric isomers of alkenes can exist.
a) These are referred to as cis
and trans isomers.
|
|
|
|
cis-2-butene |
trans-2-butene |
|
bp 4oC |
bp 1oC |
|
slightly polar |
nonpolar |
b) Is the following alkene a cis
or trans isomer?
What problem develops with this
alkene in determining if it is cis or trans?
|
|
i) To classify compounds of this type the E-Z System was developed.
2. The E-Z System.
a) Rank the atoms directly attached to the
double-bonded carbons by atomic number.
b) Compare the rankings of the two
substituents on one carbon; repeat this for the other carbon.
c) If both higher ranking groups are
cis to each other then configuration is Z (Zusammen,
together)
E (Entgegen, opposite) is
assigned if these groups are opposite each other.
d) If the atoms directly attached to a C are the same, work outward from each
point until the first
exploitable difference is found [see examples below]
|
|
|
|
|
|
3. Name the following alkenes:
|
|
|
|
|
(Z)-2-bromo-1-chloropropene |
(Z)-2-fluoro-3-methyl-2-pentene |
(E)-3-iodo-4-methyl-3-hexene |
note correction to the first name above and problem 4 below
4. Draw the structure for (E)-2-bromo-1-chloropropene:
|
Nomenclature of Stereoisomers by Linda Sweeting
at Towson University |
|
Cahn-Ingold-Prelog E/Z nomenclature of alkenes
by Dave Woodcock at OUC |
|
Stereoisomers by William Reusch at Michigan State
U |
III. Physical Properties.
A. Alkenes Are Similar to Alkanes.
1. Small dipole moments.
2. Melting and boiling points are similar: C2 to C4
alkenes are gases at room temperature.
3. Alkenes are not soluble in water.
B. Saturated vs Unsaturated Fats/Oils: Melting Points.
1. Structure of fats and oils: Triglycerides.
a) Triglycerides are esters of
glycerol and three fatty acids:
|
|
b) The R groups consist of an
odd number of carbons and can be either saturated or
unsaturated.
2. Fats are triglycerides which are highly saturated
and are solids at room temperature.
Oils are triglycerides which are highly unsaturated
and are liquids at room temperature.
3. Melting point as a function of
unsaturation.
a) Saturated fatty acids have higher melting points than unsaturated fatty
acids of similar MW.
|
|
|
|
|
CH3(CH2)16COOH |
CH3(CH2)7CH=CH(CH2)7COOH |
CH3(CH2)7CH=CH(CH2)7COOH |
|
stearic acid |
oleic acid |
elaidic acid |
|
octadecanoic acid |
(Z)-9-octadecenoic acid |
(E)-9-octadecenoic acid |
|
mp = 72oC |
mp = 13oC |
mp = 45oC |
b) Saturated fatty acids have
higher melting points due to greater van der Waals interactions and
better packing ability of their
carbon chains.
c) The Z (cis) isomers of
unsaturated fatty acids have lower melting points than the corresponding
E (trans) isomers
due to poorer packing ability [see structures above].
d) Greater unsaturation in
fatty acids results in lower melting points:
|
CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH |
CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH |
|
(9Z, 12Z)-9,12-octadecadienoic acid |
(9Z,12Z,15Z)-9,12,15-octadecatrienoic acid |
|
linoleic acid |
linolenic acid |
|
mp = −5oC |
mp = −11oC |
e) Vegetable oils are partially
hydrogenated in order to convert liquid oils into solid margarine.
i) In industry this process is
referred to as "hardening".
IV. Chemical Properties.
A. Relative Stabilities.
1. Alkene Stability [the order given for the disubstituted is NOT the one in your text] *see 3 below
|
monosub < cis-disub <
gem-disub < trans-disub
< trisub < tetrasubstituted |
|||||
|
|
|
|
|
|
|
|
least stable |
|
|
|
|
most stable |
2. Combustion Data
a) C4H8 + 6 O2 à 4CO2 + 4H2O
|
compound |
|
|
|
|
|
name |
1-butene |
cis-2-butene |
trans-2-butene |
2-methylpropene |
|
DHocomb, kJ/mol |
−2717 |
−2710 |
−2707 |
−2700 |
|
stability |
least |
|
|
most |
b) Why this order is observed is not
well understood. One theory is that alkyl groups stabilize
double bonds in the same way as
with carbocations: they release electrons into the pi system
of the alkene via hyperconjugation (overlap
of C-H sigma bond of a neighboring substituent.)
c) Another theory: sp2-sp3
bonds are stronger than sp3-sp3 bonds. The isomer
having more
sp2-sp3
bonds (compared to sp3-sp3 bonds) is more stable.
sp3- sp2 - sp2-
sp3 sp3- sp3
-
sp2- sp2
note correction
CH3-CH=CH-CH3
CH3-CH2-CH=CH2
2-butene 1-butene
more stable
less stable
3. The heat of
hydrogenation can also be used to compare stability of double bonds,
even for
compounds which are not isomers. Hydrogenation will be discussed more in Chapter
6.
B. Strain in Cycloalkenes.
1. Cyclopropene: Angle strain is present due to 120o
sp2 hybrids vs 60o angles of a triangle
a) This is greater strain than is present
in cyclopropane where 109.5o sp3 hybrids exist.
2. Cyclobutene: Less angle strain than in
cyclopropene.
3. Angle strain is negligible in cyclopentenes,
cyclohexenes, etc.
4. trans-cyclooctene is the smallest ring size
possible for the trans isomer.
5. In rings with less than 12 carbons, the cis
isomer is more stable than the trans.
a) In rings with more than 12 carbons, the
trans isomer is more stable than cis
b) (E)-Cyclododecene and (Z)-Cyclododecene
have about the same stability.
6. Bredt's rule: NO C=C at bridgehead C in
bicyclic compounds
V. Preparation of Alkenes.
| Preparation of Alkenes http://www.mhhe.com/physsci/chemistry/carey/student/olc/graphics/carey04oc/ref/ch05preparealkenes.html |
| Elimination reactions http://www.mhhe.com/physsci/chemistry/carey/student/olc/graphics/carey04oc/ref/ch05eliminationreactions.html |
| Elimination Mechanisms by Jim
Clark, Cornwall, UK http://www.chemguide.co.uk/mechanisms/elimmenu.html#top |
| Animations of E1 and E2 mechanisms
by Daniel A. Berger of Bluffton College are at http://www.bluffton.edu/~bergerd/classes/CEM221/sn-e/E1-1.html http://www.bluffton.edu/~bergerd/classes/CEM221/sn-e/E2-1.html |
| Animations of E1 and E2 mechanisms
by Jennifer L. Muzyka at Centre College http://web.centre.edu/muzyka/organic/organic.htm > Substitution and Elimination http://web.centre.edu/~muzyka/organic/e1/main.htm http://web.centre.edu/~muzyka/organic/e2/main.htm |
A. Dehydration of Alcohols
1.

2. Examples:
|
|
|
|
3. Examine this reaction:
|
|
a) Which product is preferred?
|
Zaitsev's Rule [In older texts you will see the German transliteration Saytzeff]: |
|
∙ The most substituted alkene is the most stable and will be the preferred product |
|
∙
In an elimination reaction where there are several possible H’s that can be
removed, |
|
∙ "The poor get poorer" |
4. Complete the following reactions showing the
possible products and indicate which are
major and minor products.
|
a) |
|
|
|
|
|
|
major |
minor |
|
b) |
|
|
|
|
|
|
major |
minor |
5. Reactions in which more than one constitutional
isomer can be formed from a reactant
but one predominates are REGIOSELECTIVE.
6. If one isomer is formed exclusively (or almost
exclusively): REGIOSPECIFIC.
7. Are the following products constitutional isomers?
|
|
Answer. NO: they are stereoisomers. The above reaction is STEREOSELECTIVE.
8. Mechanism for dehydration of alcohols.
a) Observations:
i) Acid Catalyzed.
ii) Order
of reactivity of
alcohols:
3o > 2o >> 1o
iii) Rearrangements can
occur.
b)
Conclusions--
i) Carbocation intermediate
ii) E1: Elimination
Unimolecular
c) Mechanism:
|
|
d) Write the mechanism for this reaction:
|
|
9. E2
a) In some cases
for 1o
alcohols:
E2, Elimination Bimolecular
|
|
b) But there is evidence that most 1o alcohols react via carbocations: Rearrangements ⇒ (E1).
|
|
i) Mechanism: (1,2 hydride shift)
|
|
10. Complete these reactions and show the mechanism. Also classify the mechanism as E1 or E2.
|
a) |
|
|
mech: |
|
|
b) |
|
|
mech: |
|
i) A 1,2 methyl shift occurs
above in part b.
ii) When do hydride and alkyl
shifts occur? If a 1,2-shift of hydrogen or alkyl group can
form a more stable
carbocation, then such a rearrangement usually takes place.
B. Dehydrohalogenation of Alkyl Halides
1.
|
|
2. Follows Zaitsev's Rule: The most substituted alkene forms.
a) This makes the reaction
regioselective.
b) The reaction is also
stereoselective: the trans (E) product is favored over the cis (Z)
product.
3. Base/Solvent Systems:
a) EtO¯Na+/EtOH
sodium ethoxide in ethanol
b) MeO¯Na+/MeOH
sodium methoxide in methanol
c) tBuO¯K+/ tBuOH (or
DMSO) potassium tert-butoxide in tert-butanol or dimethyl
sulfoxide
(good for 1o RX)
4. Complete the following:
|
a) |
|
|
b) |
|
5. Mechanism for the Dehydrohalogenation of Alkyl Halides:
a) Observations for
dehydrohalogenation of alkyl halides:
i)
Strong base required.
ii) 2nd order
kinetics. 1st order in RX, 1st order in base.
iii) The reaction rate is
highly dependent upon the identity of the halogen
(to the weakness of
the C-X bond.)
RI > RBr > RCl > RF
Fast Slow
I¯ good leaving group F¯ poor leaving group
iv) The reaction rate follows
the order:
3o
RX > 2o RX > 1o RX
v) No rearrangements
(no carbocations.)
b) Conclusion: E2- Bimolecular
Elimination
c) Mechanism:
|
|
i) A concerted
mechanism: Goes through Transition State but no intermediate.
The
following all occur simultaneously:
∙ C-H bond
breaks
∙
C=C pi
bond forms
∙
C-X bond
breaks
No carbocation: no rearrangement.
|
|
d) The E2 mechanism is favored by the use of a STRONG BASE.
|
Make this a Pavlovian reflex: |
6. Contrast this with the dehydration of a primary alcohol (E1):
7. Anti Elimination in E2 Reactions.
Stereoelectronic Effects.
a) Effects due to one spatial arrangement
of electrons/orbitals more stable than others.
|
cis-4-tert-butylcylohexyl
bromide |
trans-4-tert-butylcylohexyl bromide |
|
anti periplanar |
Br
gauche to both H's |
|
|
|
|
|
|
|
Br anti to H (anti periplanar): favorable for E2 |
Br gauche to both H's, so elimination is difficult. |
b) For the activated complex to be
stabilized by partial pi bond formation, p orbitals developing
(due to C's sp3
hybrids changing to sp2) must be parallel: pi-bond formation
is achieved
when the H-C-C-X unit is
coplanar in the transition state.
i) Two conformations permit this: syn periplanar (boat: t-butyl group axial/unfavorable) and anti periplanar.
|
|
|
|
|
|
|
syn periplanar |
anti periplanar |
|
eclipsed: energetically unfavorable |
staggered: energetically favorable |
8. Stereoselectivity in E2 Reactions.
a) The dehydrohalogenation of alkyl halides favor the formation of the trans isomer.
|
|
b) This stereoselectivity can be
understood by looking at the Newman projections of the reactant
and transition states.
c) Notice that when the reactant is in the
conformation where the methyl groups are gauche to
each other, this leads to
unfavorable steric interactions in the transition state.
|
|
i) This leads to formation of the cis product.
d) Notice that in the formation of the
trans product the transition state is more stable due to lower
van der Waals strain.
|
|
i) The trans product is formed faster than the cis product.
9. E1 and E2 for Alkyl Halides.
a) E2 Mechanism- Bimolecular
Elimination
i) Second Order
Kinetics: Rate = k[RX][base]
ii) Favored with STRONG
BASE.
iii) Favored in the
order:
3o
RX > 2o RX > 1o RX
b) E1 Mechanism- Unimolecular
Elimination
i) First order kinetics: Rate
= k[RX]
ii) Possible for 3o
and (some) 2o alkyl halides WHEN: base is weak or in low
concentrations.
iii) Since E1 reactions go
through the carbocation intermediate, rearrangements may occur:
E2 is often a better
synthetic method when rearrangement is otherwise possible.
(Use strong base.)
iv) Favored in the order:
3o
RX > 2o RX > 1o RX
v) Favored in the order:
RI >
RBr > RCl > RF
since breaking the
R-X bond is the rate determining step.
The C-I bond is
weaker than the C-F bond.
vi) Example:
|
|
c) For the above reaction:
i) Name the two products.
2-methyl-1-butene and 2-methyl-2-butene
ii) Try writing the mechanism
for the formation of the above two products.
iii) Why is one product
favored over the other?
Answer: Zaitsev's Rule is followed, which results in the formation of the more stable (more substituted) alkene.
d) E1 reactions are normally carried out in the absence of added base:
the solvent acts as the
base and a polar protic solvent
is chosen (such as an alcohol) in order to help form the
carbocation. If even small
amounts of strong base present, the E2 reaction tends to occur
faster than E1.
Many thanks to Rod Oka of
MPC for generously sharing his "Lecture Companion" outline,
reproduced here
in edited form by permission, with
web references and other goodies added by me.
Structures drawn using MDL IsisDraw™ , CS ChemOffice ChemDraw™, and
ACDLabs ChemSketch™.